About 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine
2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine (PubChem CID 103321977) has the molecular formula C14H18ClN3S
and a molecular weight of 295.84 g/mol. Its IUPAC name is 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine |
| PubChem CID | 103321977 |
| Molecular Formula | C14H18ClN3S |
| Molecular Weight | 295.84 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine |
| SMILES | Cc1cc2c(N3CCCC3C(C)C)nc(Cl)nc2s1 |
| InChI | InChI=1S/C14H18ClN3S/c1-8(2)11-5-4-6-18(11)12-10-7-9(3)19-13(10)17-14(15)16-12/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | HEUQEINBKUZETJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine?
The IUPAC name of 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine (CID 103321977) is 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine.
What is the SMILES notation for 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine?
The canonical SMILES for 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine is Cc1cc2c(N3CCCC3C(C)C)nc(Cl)nc2s1.
What is the InChIKey of 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine?
The InChIKey is HEUQEINBKUZETJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClN3S/c1-8(2)11-5-4-6-18(11)12-10-7-9(3)19-13(10)17-14(15)16-12/h7-8,11H,4-6H2,1-3H3.
What are the key properties of 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine?
2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine has a molecular weight of 295.84 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-methyl-4-(2-propan-2-ylpyrrolidin-1-yl)thieno[2,3-d]pyrimidine is sourced from PubChem (CID 103321977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).