About 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine
3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 10332328) has the molecular formula C15H10N2O2
and a molecular weight of 250.26 g/mol. Its IUPAC name is 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 10332328 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1cc(-c2cnc3[nH]cc(-c4ccoc4)c3c2)co1 |
| InChI | InChI=1S/C15H10N2O2/c1-3-18-8-10(1)12-5-13-14(11-2-4-19-9-11)7-17-15(13)16-6-12/h1-9H,(H,16,17) |
| InChIKey | KUDIAPNZZLUJQH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine (CID 10332328) is 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine is c1cc(-c2cnc3[nH]cc(-c4ccoc4)c3c2)co1.
What is the InChIKey of 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is KUDIAPNZZLUJQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O2/c1-3-18-8-10(1)12-5-13-14(11-2-4-19-9-11)7-17-15(13)16-6-12/h1-9H,(H,16,17).
What are the key properties of 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine?
3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 250.26 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(furan-3-yl)-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 10332328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).