About 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine
4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103323813) has the molecular formula C10H12N4OS
and a molecular weight of 236.30 g/mol. Its IUPAC name is 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine |
| PubChem CID | 103323813 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | Nc1nc(N2CCOCC2)c2ccsc2n1 |
| InChI | InChI=1S/C10H12N4OS/c11-10-12-8(14-2-4-15-5-3-14)7-1-6-16-9(7)13-10/h1,6H,2-5H2,(H2,11,12,13) |
| InChIKey | TVFKRUBCTSGHJI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine?
The IUPAC name of 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine (CID 103323813) is 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine?
The canonical SMILES for 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine is Nc1nc(N2CCOCC2)c2ccsc2n1.
What is the InChIKey of 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine?
The InChIKey is TVFKRUBCTSGHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4OS/c11-10-12-8(14-2-4-15-5-3-14)7-1-6-16-9(7)13-10/h1,6H,2-5H2,(H2,11,12,13).
What are the key properties of 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine?
4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine has a molecular weight of 236.30 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-4-ylthieno[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 103323813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).