C15H22N4S — CID 103323872
4-(azepan-1-yl)-N-ethyl-6-methylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103323872) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-ethyl-6-methylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-ethyl-6-methylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103323872 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-(azepan-1-yl)-N-ethyl-6-methylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCNc1nc(N2CCCCCC2)c2cc(C)sc2n1 |
| InChI | InChI=1S/C15H22N4S/c1-3-16-15-17-13(19-8-6-4-5-7-9-19)12-10-11(2)20-14(12)18-15/h10H,3-9H2,1-2H3,(H,16,17,18) |
| InChIKey | GZCKAXGPXVGTKT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |