C14H22O4 — CID 10332541
(2S,3R,6R)-6-(4-methylphenyl)heptane-1,2,3,6-tetrol (PubChem CID 10332541) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (2S,3R,6R)-6-(4-methylphenyl)heptane-1,2,3,6-tetrol.
| Compound Name | (2S,3R,6R)-6-(4-methylphenyl)heptane-1,2,3,6-tetrol |
|---|---|
| PubChem CID | 10332541 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (2S,3R,6R)-6-(4-methylphenyl)heptane-1,2,3,6-tetrol |
| SMILES | Cc1ccc([C@](C)(O)CC[C@@H](O)[C@@H](O)CO)cc1 |
| InChI | InChI=1S/C14H22O4/c1-10-3-5-11(6-4-10)14(2,18)8-7-12(16)13(17)9-15/h3-6,12-13,15-18H,7-9H2,1-2H3/t12-,13+,14-/m1/s1 |
| InChIKey | ULSOQSMCXGTLSD-HZSPNIEDSA-N |
| XLogP | 0.70 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |