C15H15NO3 — CID 10332682
4-(hydroxymethyl)-1,6,8-trimethylfuro[2,3-h]quinolin-2-one (PubChem CID 10332682) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1,6,8-trimethylfuro[2,3-h]quinolin-2-one.
| Compound Name | 4-(hydroxymethyl)-1,6,8-trimethylfuro[2,3-h]quinolin-2-one |
|---|---|
| PubChem CID | 10332682 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 4-(hydroxymethyl)-1,6,8-trimethylfuro[2,3-h]quinolin-2-one |
| SMILES | Cc1cc2c(o1)c(C)cc1c(CO)cc(=O)n(C)c12 |
| InChI | InChI=1S/C15H15NO3/c1-8-4-11-10(7-17)6-13(18)16(3)14(11)12-5-9(2)19-15(8)12/h4-6,17H,7H2,1-3H3 |
| InChIKey | KBZQZIDDCIRMKQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |