About dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate
dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate (PubChem CID 10332819) has the molecular formula C13H12N2O4
and a molecular weight of 260.25 g/mol. Its IUPAC name is dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate |
| PubChem CID | 10332819 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nc(-c2ccccc2)[nH]c1C(=O)OC |
| InChI | InChI=1S/C13H12N2O4/c1-18-12(16)9-10(13(17)19-2)15-11(14-9)8-6-4-3-5-7-8/h3-7H,1-2H3,(H,14,15) |
| InChIKey | HHXCJFMOJFOZCJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate?
The IUPAC name of dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate (CID 10332819) is dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate.
What is the SMILES notation for dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate?
The canonical SMILES for dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate is COC(=O)c1nc(-c2ccccc2)[nH]c1C(=O)OC.
What is the InChIKey of dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate?
The InChIKey is HHXCJFMOJFOZCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O4/c1-18-12(16)9-10(13(17)19-2)15-11(14-9)8-6-4-3-5-7-8/h3-7H,1-2H3,(H,14,15).
What are the key properties of dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate?
dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate has a molecular weight of 260.25 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-phenyl-1H-imidazole-4,5-dicarboxylate is sourced from PubChem (CID 10332819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).