C13H20N4OS — CID 103328395
4-[[2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-2-ol (PubChem CID 103328395) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is 4-[[2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-2-ol.
| Compound Name | 4-[[2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-2-ol |
|---|---|
| PubChem CID | 103328395 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-[[2-(propylamino)thieno[2,3-d]pyrimidin-4-yl]amino]butan-2-ol |
| SMILES | CCCNc1nc(NCCC(C)O)c2ccsc2n1 |
| InChI | InChI=1S/C13H20N4OS/c1-3-6-15-13-16-11(14-7-4-9(2)18)10-5-8-19-12(10)17-13/h5,8-9,18H,3-4,6-7H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | JXGAEKQXHWFFLS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |