C12H13N5O2S — CID 103328728
4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 103328728) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 103328728 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1c1nc(N)nc2sccc12 |
| InChI | InChI=1S/C12H13N5O2S/c1-12(2)10(19)14-7(18)5-17(12)8-6-3-4-20-9(6)16-11(13)15-8/h3-4H,5H2,1-2H3,(H2,13,15,16)(H,14,18,19) |
| InChIKey | KDJMGOKKYFTTSF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|