C18H18S — CID 10333165
16,16-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-thiol (PubChem CID 10333165) has the molecular formula C18H18S and a molecular weight of 266.41 g/mol. Its IUPAC name is 16,16-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-thiol.
| Compound Name | 16,16-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-thiol |
|---|---|
| PubChem CID | 10333165 |
| Molecular Formula | C18H18S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 16,16-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-thiol |
| SMILES | CC1(C)C2c3ccccc3C(c3ccccc32)C1S |
| InChI | InChI=1S/C18H18S/c1-18(2)16-13-9-5-3-7-11(13)15(17(18)19)12-8-4-6-10-14(12)16/h3-10,15-17,19H,1-2H3 |
| InChIKey | AALLWPQIRUWASQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|