About 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide
4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide (PubChem CID 103331970) has the molecular formula C13H10N4O2S
and a molecular weight of 286.32 g/mol. Its IUPAC name is 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide.
Molecular Properties
| Compound Name | 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide |
| PubChem CID | 103331970 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide |
| SMILES | NC(=O)c1ccc(Oc2nc(N)nc3sccc23)cc1 |
| InChI | InChI=1S/C13H10N4O2S/c14-10(18)7-1-3-8(4-2-7)19-11-9-5-6-20-12(9)17-13(15)16-11/h1-6H,(H2,14,18)(H2,15,16,17) |
| InChIKey | YPNVHWMVEISZJY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide?
The IUPAC name of 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide (CID 103331970) is 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide.
What is the SMILES notation for 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide?
The canonical SMILES for 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide is NC(=O)c1ccc(Oc2nc(N)nc3sccc23)cc1.
What is the InChIKey of 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide?
The InChIKey is YPNVHWMVEISZJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O2S/c14-10(18)7-1-3-8(4-2-7)19-11-9-5-6-20-12(9)17-13(15)16-11/h1-6H,(H2,14,18)(H2,15,16,17).
What are the key properties of 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide?
4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide has a molecular weight of 286.32 g/mol, XLogP of 2.16, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminothieno[2,3-d]pyrimidin-4-yl)oxybenzamide is sourced from PubChem (CID 103331970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).