C13H18ClNOSi — CID 10333223
(4S,5S)-2-chloro-3,4-dimethyl-5-phenyl-2-prop-2-enyl-1,3,2-oxazasilolidine (PubChem CID 10333223) has the molecular formula C13H18ClNOSi and a molecular weight of 267.83 g/mol. Its IUPAC name is (4S,5S)-2-chloro-3,4-dimethyl-5-phenyl-2-prop-2-enyl-1,3,2-oxazasilolidine.
| Compound Name | (4S,5S)-2-chloro-3,4-dimethyl-5-phenyl-2-prop-2-enyl-1,3,2-oxazasilolidine |
|---|---|
| PubChem CID | 10333223 |
| Molecular Formula | C13H18ClNOSi |
| Molecular Weight | 267.83 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | (4S,5S)-2-chloro-3,4-dimethyl-5-phenyl-2-prop-2-enyl-1,3,2-oxazasilolidine |
| SMILES | C=CC[Si]1(Cl)O[C@@H](c2ccccc2)[C@H](C)N1C |
| InChI | InChI=1S/C13H18ClNOSi/c1-4-10-17(14)15(3)11(2)13(16-17)12-8-6-5-7-9-12/h4-9,11,13H,1,10H2,2-3H3/t11-,13+,17?/m0/s1 |
| InChIKey | XHCRAANIMMYPDV-APBZJUGRSA-N |
| XLogP | 3.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.83 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|