About 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine
7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine (PubChem CID 10333226) has the molecular formula C8H2Cl2F3N3
and a molecular weight of 268.03 g/mol. Its IUPAC name is 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine.
Molecular Properties
| Compound Name | 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine |
| PubChem CID | 10333226 |
| Molecular Formula | C8H2Cl2F3N3 |
| Molecular Weight | 268.03 g/mol |
| Exact Mass | 266.96 |
| IUPAC Name | 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine |
| SMILES | FC(F)(F)c1nnc2c(Cl)c(Cl)ccc2n1 |
| InChI | InChI=1S/C8H2Cl2F3N3/c9-3-1-2-4-6(5(3)10)15-16-7(14-4)8(11,12)13/h1-2H |
| InChIKey | KFDHMOJUDDYVMD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.03 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine?
The IUPAC name of 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine (CID 10333226) is 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine.
What is the SMILES notation for 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine?
The canonical SMILES for 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine is FC(F)(F)c1nnc2c(Cl)c(Cl)ccc2n1.
What is the InChIKey of 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine?
The InChIKey is KFDHMOJUDDYVMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2Cl2F3N3/c9-3-1-2-4-6(5(3)10)15-16-7(14-4)8(11,12)13/h1-2H.
What are the key properties of 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine?
7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine has a molecular weight of 268.03 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dichloro-3-(trifluoromethyl)-1,2,4-benzotriazine is sourced from PubChem (CID 10333226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).