C16H17N3S2 — CID 103334260
4-benzylsulfanyl-6-ethyl-N-methylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103334260) has the molecular formula C16H17N3S2 and a molecular weight of 315.47 g/mol. Its IUPAC name is 4-benzylsulfanyl-6-ethyl-N-methylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-benzylsulfanyl-6-ethyl-N-methylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103334260 |
| Molecular Formula | C16H17N3S2 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-benzylsulfanyl-6-ethyl-N-methylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCc1cc2c(SCc3ccccc3)nc(NC)nc2s1 |
| InChI | InChI=1S/C16H17N3S2/c1-3-12-9-13-14(18-16(17-2)19-15(13)21-12)20-10-11-7-5-4-6-8-11/h4-9H,3,10H2,1-2H3,(H,17,18,19) |
| InChIKey | LZVFQMJZNJNLRM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |