C10H12F3N5S — CID 103334358
2-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103334358) has the molecular formula C10H12F3N5S and a molecular weight of 291.30 g/mol. Its IUPAC name is 2-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103334358 |
| Molecular Formula | C10H12F3N5S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-hydrazinyl-N-methyl-N-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN(CCC(F)(F)F)c1nc(NN)nc2sccc12 |
| InChI | InChI=1S/C10H12F3N5S/c1-18(4-3-10(11,12)13)7-6-2-5-19-8(6)16-9(15-7)17-14/h2,5H,3-4,14H2,1H3,(H,15,16,17) |
| InChIKey | COJMBPOQZBGOOI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|