C14H10O4S — CID 10333539
1-(10,10-dioxophenoxathiin-1-yl)ethanone (PubChem CID 10333539) has the molecular formula C14H10O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is 1-(10,10-dioxophenoxathiin-1-yl)ethanone.
| Compound Name | 1-(10,10-dioxophenoxathiin-1-yl)ethanone |
|---|---|
| PubChem CID | 10333539 |
| Molecular Formula | C14H10O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 1-(10,10-dioxophenoxathiin-1-yl)ethanone |
| SMILES | CC(=O)c1cccc2c1S(=O)(=O)c1ccccc1O2 |
| InChI | InChI=1S/C14H10O4S/c1-9(15)10-5-4-7-12-14(10)19(16,17)13-8-3-2-6-11(13)18-12/h2-8H,1H3 |
| InChIKey | UALGAWZECPBKOD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |