About [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate
[benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate (PubChem CID 10333608) has the molecular formula C16H21NO3
and a molecular weight of 275.35 g/mol. Its IUPAC name is [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate.
Molecular Properties
| Compound Name | [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate |
| PubChem CID | 10333608 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate |
| SMILES | CC(=O)ON(/C=C\C(=O)C(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-13(18)20-17(11-10-15(19)16(2,3)4)12-14-8-6-5-7-9-14/h5-11H,12H2,1-4H3/b11-10- |
| InChIKey | MHNWZOCABKXDKJ-KHPPLWFESA-N |
| XLogP | 3.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate?
The IUPAC name of [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate (CID 10333608) is [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate.
What is the SMILES notation for [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate?
The canonical SMILES for [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate is CC(=O)ON(/C=C\C(=O)C(C)(C)C)Cc1ccccc1.
What is the InChIKey of [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate?
The InChIKey is MHNWZOCABKXDKJ-KHPPLWFESA-N. The full InChI is InChI=1S/C16H21NO3/c1-13(18)20-17(11-10-15(19)16(2,3)4)12-14-8-6-5-7-9-14/h5-11H,12H2,1-4H3/b11-10-.
What are the key properties of [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate?
[benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate has a molecular weight of 275.35 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [benzyl-[(Z)-4,4-dimethyl-3-oxopent-1-enyl]amino] acetate is sourced from PubChem (CID 10333608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).