C16H23NO3 — CID 10333734
2-(1,3-dioxan-2-yloxy)-1,1,3,3-tetramethylisoindole (PubChem CID 10333734) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 2-(1,3-dioxan-2-yloxy)-1,1,3,3-tetramethylisoindole.
| Compound Name | 2-(1,3-dioxan-2-yloxy)-1,1,3,3-tetramethylisoindole |
|---|---|
| PubChem CID | 10333734 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2-(1,3-dioxan-2-yloxy)-1,1,3,3-tetramethylisoindole |
| SMILES | CC1(C)c2ccccc2C(C)(C)N1OC1OCCCO1 |
| InChI | InChI=1S/C16H23NO3/c1-15(2)12-8-5-6-9-13(12)16(3,4)17(15)20-14-18-10-7-11-19-14/h5-6,8-9,14H,7,10-11H2,1-4H3 |
| InChIKey | OQNBNCIQUWPYNK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |