methyl (2R)-2-(2,5-dichlorophenoxy)propanoate

C10H10Cl2O3 — CID 103337705

IUPACmethyl (2R)-2-(2,5-dichlorophenoxy)propanoate
SMILESCOC(=O)[C@@H](C)Oc1cc(Cl)ccc1Cl
InChIInChI=1S/C10H10Cl2O3/c1-6(10(13)14-2)15-9-5-7(11)3-4-8(9)12/h3-6H,1-2H3/t6-/m1/s1
InChIKeyUHOPIIOVPMEDGU-ZCFIWIBFSA-N
MW249.09 g/mol
LogP2.93
Rot. Bonds3

About methyl (2R)-2-(2,5-dichlorophenoxy)propanoate

methyl (2R)-2-(2,5-dichlorophenoxy)propanoate (PubChem CID 103337705) has the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. Its IUPAC name is methyl (2R)-2-(2,5-dichlorophenoxy)propanoate.

Molecular Properties

Compound Namemethyl (2R)-2-(2,5-dichlorophenoxy)propanoate
PubChem CID103337705
Molecular FormulaC10H10Cl2O3
Molecular Weight249.09 g/mol
Exact Mass248.00
IUPAC Namemethyl (2R)-2-(2,5-dichlorophenoxy)propanoate
SMILESCOC(=O)[C@@H](C)Oc1cc(Cl)ccc1Cl
InChIInChI=1S/C10H10Cl2O3/c1-6(10(13)14-2)15-9-5-7(11)3-4-8(9)12/h3-6H,1-2H3/t6-/m1/s1
InChIKeyUHOPIIOVPMEDGU-ZCFIWIBFSA-N
XLogP2.93
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.09
LogP ≤ 52.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (2R)-2-(2,5-dichlorophenoxy)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-(2,5-dichlorophenoxy)propanoate?
The IUPAC name of methyl (2R)-2-(2,5-dichlorophenoxy)propanoate (CID 103337705) is methyl (2R)-2-(2,5-dichlorophenoxy)propanoate.
What is the SMILES notation for methyl (2R)-2-(2,5-dichlorophenoxy)propanoate?
The canonical SMILES for methyl (2R)-2-(2,5-dichlorophenoxy)propanoate is COC(=O)[C@@H](C)Oc1cc(Cl)ccc1Cl.
What is the InChIKey of methyl (2R)-2-(2,5-dichlorophenoxy)propanoate?
The InChIKey is UHOPIIOVPMEDGU-ZCFIWIBFSA-N. The full InChI is InChI=1S/C10H10Cl2O3/c1-6(10(13)14-2)15-9-5-7(11)3-4-8(9)12/h3-6H,1-2H3/t6-/m1/s1.
What are the key properties of methyl (2R)-2-(2,5-dichlorophenoxy)propanoate?
methyl (2R)-2-(2,5-dichlorophenoxy)propanoate has a molecular weight of 249.09 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-(2,5-dichlorophenoxy)propanoate is sourced from PubChem (CID 103337705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).