About (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone
(2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone (PubChem CID 10333832) has the molecular formula C17H17N3O
and a molecular weight of 279.34 g/mol. Its IUPAC name is (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone |
| PubChem CID | 10333832 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone |
| SMILES | CC(C)(C)c1cn2nc(C(=O)c3ccccc3)ccc2n1 |
| InChI | InChI=1S/C17H17N3O/c1-17(2,3)14-11-20-15(18-14)10-9-13(19-20)16(21)12-7-5-4-6-8-12/h4-11H,1-3H3 |
| InChIKey | FWZRWOYBYJUVLU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone?
The IUPAC name of (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone (CID 10333832) is (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone.
What is the SMILES notation for (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone?
The canonical SMILES for (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone is CC(C)(C)c1cn2nc(C(=O)c3ccccc3)ccc2n1.
What is the InChIKey of (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone?
The InChIKey is FWZRWOYBYJUVLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O/c1-17(2,3)14-11-20-15(18-14)10-9-13(19-20)16(21)12-7-5-4-6-8-12/h4-11H,1-3H3.
What are the key properties of (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone?
(2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone has a molecular weight of 279.34 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butylimidazo[1,2-b]pyridazin-6-yl)-phenylmethanone is sourced from PubChem (CID 10333832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).