C13H26N2O2 — CID 103339322
N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-(2-methoxyethyl)prop-2-en-1-amine (PubChem CID 103339322) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-(2-methoxyethyl)prop-2-en-1-amine.
| Compound Name | N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-(2-methoxyethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103339322 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-(2-methoxyethyl)prop-2-en-1-amine |
| SMILES | C=CCN(CCOC)CC1(CN)CCOCC1 |
| InChI | InChI=1S/C13H26N2O2/c1-3-6-15(7-10-16-2)12-13(11-14)4-8-17-9-5-13/h3H,1,4-12,14H2,2H3 |
| InChIKey | VZONVIYMYPSKRB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|