About 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one
11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one (PubChem CID 10333982) has the molecular formula C16H14N2OS
and a molecular weight of 282.37 g/mol. Its IUPAC name is 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one.
Molecular Properties
| Compound Name | 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one |
| PubChem CID | 10333982 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one |
| SMILES | CC1CCc2nc3sc4ccccc4c3c(N)c2C1=O |
| InChI | InChI=1S/C16H14N2OS/c1-8-6-7-10-13(15(8)19)14(17)12-9-4-2-3-5-11(9)20-16(12)18-10/h2-5,8H,6-7H2,1H3,(H2,17,18) |
| InChIKey | KCFSPKSSRQDYFQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one?
The IUPAC name of 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one (CID 10333982) is 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one.
What is the SMILES notation for 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one?
The canonical SMILES for 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one is CC1CCc2nc3sc4ccccc4c3c(N)c2C1=O.
What is the InChIKey of 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one?
The InChIKey is KCFSPKSSRQDYFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2OS/c1-8-6-7-10-13(15(8)19)14(17)12-9-4-2-3-5-11(9)20-16(12)18-10/h2-5,8H,6-7H2,1H3,(H2,17,18).
What are the key properties of 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one?
11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one has a molecular weight of 282.37 g/mol, XLogP of 3.80, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11-amino-9-methyl-8,9-dihydro-7H-[1]benzothiolo[2,3-b]quinolin-10-one is sourced from PubChem (CID 10333982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).