About N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide
N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide (PubChem CID 103339974) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide |
| PubChem CID | 103339974 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide |
| SMILES | C=CCN(CCOC)C(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C12H19N3O2/c1-5-6-15(7-8-17-4)12(16)11-9(2)13-14-10(11)3/h5H,1,6-8H2,2-4H3,(H,13,14) |
| InChIKey | RBVNXQYECRSCGA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide?
The IUPAC name of N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide (CID 103339974) is N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide.
What is the SMILES notation for N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide?
The canonical SMILES for N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide is C=CCN(CCOC)C(=O)c1c(C)n[nH]c1C.
What is the InChIKey of N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide?
The InChIKey is RBVNXQYECRSCGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-5-6-15(7-8-17-4)12(16)11-9(2)13-14-10(11)3/h5H,1,6-8H2,2-4H3,(H,13,14).
What are the key properties of N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide?
N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide has a molecular weight of 237.30 g/mol, XLogP of 1.30, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enyl-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 103339974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).