C16H20N2O2 — CID 103340021
[2-[2-methoxyethyl(prop-2-enyl)amino]quinolin-4-yl]methanol (PubChem CID 103340021) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is [2-[2-methoxyethyl(prop-2-enyl)amino]quinolin-4-yl]methanol.
| Compound Name | [2-[2-methoxyethyl(prop-2-enyl)amino]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 103340021 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [2-[2-methoxyethyl(prop-2-enyl)amino]quinolin-4-yl]methanol |
| SMILES | C=CCN(CCOC)c1cc(CO)c2ccccc2n1 |
| InChI | InChI=1S/C16H20N2O2/c1-3-8-18(9-10-20-2)16-11-13(12-19)14-6-4-5-7-15(14)17-16/h3-7,11,19H,1,8-10,12H2,2H3 |
| InChIKey | AMAXGFVXPGZDNU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|