About 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane
3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane (PubChem CID 10334032) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane.
Molecular Properties
| Compound Name | 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane |
| PubChem CID | 10334032 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane |
| SMILES | c1ccc(OCc2ccccc2CN2CCCOC2)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-2-9-18(10-3-1)21-14-17-8-5-4-7-16(17)13-19-11-6-12-20-15-19/h1-5,7-10H,6,11-15H2 |
| InChIKey | KMVZEGKHXITGOD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane?
The IUPAC name of 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane (CID 10334032) is 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane.
What is the SMILES notation for 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane?
The canonical SMILES for 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane is c1ccc(OCc2ccccc2CN2CCCOC2)cc1.
What is the InChIKey of 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane?
The InChIKey is KMVZEGKHXITGOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-2-9-18(10-3-1)21-14-17-8-5-4-7-16(17)13-19-11-6-12-20-15-19/h1-5,7-10H,6,11-15H2.
What are the key properties of 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane?
3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane has a molecular weight of 283.37 g/mol, XLogP of 3.45, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(phenoxymethyl)phenyl]methyl]-1,3-oxazinane is sourced from PubChem (CID 10334032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).