C12H16N2O4S — CID 10334069
(1-methyl-5-oxo-2-pyridin-3-ylpyrrolidin-3-yl)methyl methanesulfonate (PubChem CID 10334069) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is (1-methyl-5-oxo-2-pyridin-3-ylpyrrolidin-3-yl)methyl methanesulfonate.
| Compound Name | (1-methyl-5-oxo-2-pyridin-3-ylpyrrolidin-3-yl)methyl methanesulfonate |
|---|---|
| PubChem CID | 10334069 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (1-methyl-5-oxo-2-pyridin-3-ylpyrrolidin-3-yl)methyl methanesulfonate |
| SMILES | CN1C(=O)CC(COS(C)(=O)=O)C1c1cccnc1 |
| InChI | InChI=1S/C12H16N2O4S/c1-14-11(15)6-10(8-18-19(2,16)17)12(14)9-4-3-5-13-7-9/h3-5,7,10,12H,6,8H2,1-2H3 |
| InChIKey | ZNFLXUGDVSCBSI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|