About (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate
(3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate (PubChem CID 10334112) has the molecular formula C8H6F3NO5S
and a molecular weight of 285.20 g/mol. Its IUPAC name is (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate |
| PubChem CID | 10334112 |
| Molecular Formula | C8H6F3NO5S |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)C(O)ON2)C(F)(F)F |
| InChI | InChI=1S/C8H6F3NO5S/c9-8(10,11)18(14,15)17-4-1-2-6-5(3-4)7(13)16-12-6/h1-3,7,12-13H |
| InChIKey | TYOMSHJLTHQOON-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate?
The IUPAC name of (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate (CID 10334112) is (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate.
What is the SMILES notation for (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate?
The canonical SMILES for (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate is O=S(=O)(Oc1ccc2c(c1)C(O)ON2)C(F)(F)F.
What is the InChIKey of (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate?
The InChIKey is TYOMSHJLTHQOON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO5S/c9-8(10,11)18(14,15)17-4-1-2-6-5(3-4)7(13)16-12-6/h1-3,7,12-13H.
What are the key properties of (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate?
(3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate has a molecular weight of 285.20 g/mol, XLogP of 1.26, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-1,3-dihydro-2,1-benzoxazol-5-yl) trifluoromethanesulfonate is sourced from PubChem (CID 10334112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).