About 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea
3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea (PubChem CID 10334137) has the molecular formula C14H15N5S
and a molecular weight of 285.38 g/mol. Its IUPAC name is 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea.
Molecular Properties
| Compound Name | 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea |
| PubChem CID | 10334137 |
| Molecular Formula | C14H15N5S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)NN=C(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C14H15N5S/c1-19(2)14(20)18-17-13(11-7-3-5-9-15-11)12-8-4-6-10-16-12/h3-10H,1-2H3,(H,18,20) |
| InChIKey | XOBIGRNRXCAMJQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea?
The IUPAC name of 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea (CID 10334137) is 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea.
What is the SMILES notation for 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea?
The canonical SMILES for 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea is CN(C)C(=S)NN=C(c1ccccn1)c1ccccn1.
What is the InChIKey of 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea?
The InChIKey is XOBIGRNRXCAMJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N5S/c1-19(2)14(20)18-17-13(11-7-3-5-9-15-11)12-8-4-6-10-16-12/h3-10H,1-2H3,(H,18,20).
What are the key properties of 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea?
3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea has a molecular weight of 285.38 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea is sourced from PubChem (CID 10334137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).