About 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine
5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine (PubChem CID 103341544) has the molecular formula C7H7N3S
and a molecular weight of 165.22 g/mol. Its IUPAC name is 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine |
| PubChem CID | 103341544 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(-c2ccc[nH]2)s1 |
| InChI | InChI=1S/C7H7N3S/c8-7-10-4-6(11-7)5-2-1-3-9-5/h1-4,9H,(H2,8,10) |
| InChIKey | JCEMPPQGKWHDJD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine?
The IUPAC name of 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine (CID 103341544) is 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine is Nc1ncc(-c2ccc[nH]2)s1.
What is the InChIKey of 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine?
The InChIKey is JCEMPPQGKWHDJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S/c8-7-10-4-6(11-7)5-2-1-3-9-5/h1-4,9H,(H2,8,10).
What are the key properties of 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine?
5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine has a molecular weight of 165.22 g/mol, XLogP of 1.72, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-pyrrol-2-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 103341544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).