C12H19N3O4S — CID 103342672
2-[methyl-[(1-methylimidazol-2-yl)methyl]sulfamoyl]cyclopentane-1-carboxylic acid (PubChem CID 103342672) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[methyl-[(1-methylimidazol-2-yl)methyl]sulfamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[methyl-[(1-methylimidazol-2-yl)methyl]sulfamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103342672 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[methyl-[(1-methylimidazol-2-yl)methyl]sulfamoyl]cyclopentane-1-carboxylic acid |
| SMILES | CN(Cc1nccn1C)S(=O)(=O)C1CCCC1C(=O)O |
| InChI | InChI=1S/C12H19N3O4S/c1-14-7-6-13-11(14)8-15(2)20(18,19)10-5-3-4-9(10)12(16)17/h6-7,9-10H,3-5,8H2,1-2H3,(H,16,17) |
| InChIKey | VIXNRGWDODAMGC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |