C9H15N5O4S — CID 103342859
methyl 2-(2H-tetrazol-5-ylmethylsulfamoyl)cyclopentane-1-carboxylate (PubChem CID 103342859) has the molecular formula C9H15N5O4S and a molecular weight of 289.32 g/mol. Its IUPAC name is methyl 2-(2H-tetrazol-5-ylmethylsulfamoyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 2-(2H-tetrazol-5-ylmethylsulfamoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103342859 |
| Molecular Formula | C9H15N5O4S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | methyl 2-(2H-tetrazol-5-ylmethylsulfamoyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1S(=O)(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C9H15N5O4S/c1-18-9(15)6-3-2-4-7(6)19(16,17)10-5-8-11-13-14-12-8/h6-7,10H,2-5H2,1H3,(H,11,12,13,14) |
| InChIKey | VXPGRKSTXOKINJ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |