About methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate
methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate (PubChem CID 103343141) has the molecular formula C11H18F3NO4S
and a molecular weight of 317.33 g/mol. Its IUPAC name is methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate |
| PubChem CID | 103343141 |
| Molecular Formula | C11H18F3NO4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1S(=O)(=O)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C11H18F3NO4S/c1-15(7-6-11(12,13)14)20(17,18)9-5-3-4-8(9)10(16)19-2/h8-9H,3-7H2,1-2H3 |
| InChIKey | SXJAWBYNTSVVRP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate?
The IUPAC name of methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate (CID 103343141) is methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate.
What is the SMILES notation for methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate?
The canonical SMILES for methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate is COC(=O)C1CCCC1S(=O)(=O)N(C)CCC(F)(F)F.
What is the InChIKey of methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate?
The InChIKey is SXJAWBYNTSVVRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO4S/c1-15(7-6-11(12,13)14)20(17,18)9-5-3-4-8(9)10(16)19-2/h8-9H,3-7H2,1-2H3.
What are the key properties of methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate?
methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate has a molecular weight of 317.33 g/mol, XLogP of 1.54, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[methyl(3,3,3-trifluoropropyl)sulfamoyl]cyclopentane-1-carboxylate is sourced from PubChem (CID 103343141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).