C14H15FN4S — CID 10334411
2-[6-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine (PubChem CID 10334411) has the molecular formula C14H15FN4S and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[6-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine.
| Compound Name | 2-[6-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 10334411 |
| Molecular Formula | C14H15FN4S |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-[6-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc2c(s1)CC(c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C14H15FN4S/c15-10-4-1-8(2-5-10)9-3-6-11-12(7-9)20-14(18-11)19-13(16)17/h1-2,4-5,9H,3,6-7H2,(H4,16,17,18,19) |
| InChIKey | IRVMFCFOFBGZBJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|