C11H17BrN2OS2 — CID 103344279
5-(1-bromopropyl)-3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazole (PubChem CID 103344279) has the molecular formula C11H17BrN2OS2 and a molecular weight of 337.31 g/mol. Its IUPAC name is 5-(1-bromopropyl)-3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(1-bromopropyl)-3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103344279 |
| Molecular Formula | C11H17BrN2OS2 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 5-(1-bromopropyl)-3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazole |
| SMILES | CCC(Br)c1nc(C2CSC(C)C(C)S2)no1 |
| InChI | InChI=1S/C11H17BrN2OS2/c1-4-8(12)11-13-10(14-15-11)9-5-16-6(2)7(3)17-9/h6-9H,4-5H2,1-3H3 |
| InChIKey | CFFWJPUNKDIGNA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|