C15H19N3OS2 — CID 103344533
2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-methylaniline (PubChem CID 103344533) has the molecular formula C15H19N3OS2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-methylaniline.
| Compound Name | 2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-methylaniline |
|---|---|
| PubChem CID | 103344533 |
| Molecular Formula | C15H19N3OS2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-methylaniline |
| SMILES | Cc1ccc(N)c(-c2nc(C3CSC(C)C(C)S3)no2)c1 |
| InChI | InChI=1S/C15H19N3OS2/c1-8-4-5-12(16)11(6-8)15-17-14(18-19-15)13-7-20-9(2)10(3)21-13/h4-6,9-10,13H,7,16H2,1-3H3 |
| InChIKey | MKCXPUPMYGEGPS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|