C11H16F3N3OS2 — CID 103344555
2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-amine (PubChem CID 103344555) has the molecular formula C11H16F3N3OS2 and a molecular weight of 327.40 g/mol. Its IUPAC name is 2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-amine.
| Compound Name | 2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-amine |
|---|---|
| PubChem CID | 103344555 |
| Molecular Formula | C11H16F3N3OS2 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-amine |
| SMILES | CC1SCC(c2noc(C(C)(N)C(F)(F)F)n2)SC1C |
| InChI | InChI=1S/C11H16F3N3OS2/c1-5-6(2)20-7(4-19-5)8-16-9(18-17-8)10(3,15)11(12,13)14/h5-7H,4,15H2,1-3H3 |
| InChIKey | VEUPCRNVMTXNMX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |