C13H22OS2 — CID 103344818
2-cyclopentyl-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanone (PubChem CID 103344818) has the molecular formula C13H22OS2 and a molecular weight of 258.45 g/mol. Its IUPAC name is 2-cyclopentyl-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanone.
| Compound Name | 2-cyclopentyl-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanone |
|---|---|
| PubChem CID | 103344818 |
| Molecular Formula | C13H22OS2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-cyclopentyl-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanone |
| SMILES | CC1SCC(C(=O)CC2CCCC2)SC1C |
| InChI | InChI=1S/C13H22OS2/c1-9-10(2)16-13(8-15-9)12(14)7-11-5-3-4-6-11/h9-11,13H,3-8H2,1-2H3 |
| InChIKey | VREIYGJFWURCIV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |