C15H20O3S2 — CID 103344886
(3,5-dimethoxyphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanone (PubChem CID 103344886) has the molecular formula C15H20O3S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanone.
| Compound Name | (3,5-dimethoxyphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 103344886 |
| Molecular Formula | C15H20O3S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (3,5-dimethoxyphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)C2CSC(C)C(C)S2)c1 |
| InChI | InChI=1S/C15H20O3S2/c1-9-10(2)20-14(8-19-9)15(16)11-5-12(17-3)7-13(6-11)18-4/h5-7,9-10,14H,8H2,1-4H3 |
| InChIKey | DMTNHAPQCCBPKC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |