About iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate
iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate (PubChem CID 10334491) has the molecular formula C10H8FeN2O3S
and a molecular weight of 292.10 g/mol. Its IUPAC name is iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate |
| PubChem CID | 10334491 |
| Molecular Formula | C10H8FeN2O3S |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate |
| SMILES | CC1(C(=O)[O-])CSC(c2ncccc2[O-])=N1.[Fe+2] |
| InChI | InChI=1S/C10H10N2O3S.Fe/c1-10(9(14)15)5-16-8(12-10)7-6(13)3-2-4-11-7;/h2-4,13H,5H2,1H3,(H,14,15);/q;+2/p-2 |
| InChIKey | ZYDQAVJMLVRLNB-UHFFFAOYSA-L |
| XLogP | -0.85 |
| TPSA | 88.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate?
The IUPAC name of iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate (CID 10334491) is iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate.
What is the SMILES notation for iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate?
The canonical SMILES for iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate is CC1(C(=O)[O-])CSC(c2ncccc2[O-])=N1.[Fe+2].
What is the InChIKey of iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate?
The InChIKey is ZYDQAVJMLVRLNB-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H10N2O3S.Fe/c1-10(9(14)15)5-16-8(12-10)7-6(13)3-2-4-11-7;/h2-4,13H,5H2,1H3,(H,14,15);/q;+2/p-2.
What are the key properties of iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate?
iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate has a molecular weight of 292.10 g/mol, XLogP of -0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);4-methyl-2-(3-oxido-2-pyridinyl)-5H-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 10334491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).