About (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone
(5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone (PubChem CID 103345007) has the molecular formula C16H26O2S2
and a molecular weight of 314.52 g/mol. Its IUPAC name is (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone.
Molecular Properties
| Compound Name | (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone |
| PubChem CID | 103345007 |
| Molecular Formula | C16H26O2S2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone |
| SMILES | CC1SCC(C(=O)C2CCOC3(CCCC3)C2)SC1C |
| InChI | InChI=1S/C16H26O2S2/c1-11-12(2)20-14(10-19-11)15(17)13-5-8-18-16(9-13)6-3-4-7-16/h11-14H,3-10H2,1-2H3 |
| InChIKey | KDRWXXKACFKOOT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone?
The IUPAC name of (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone (CID 103345007) is (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone.
What is the SMILES notation for (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone?
The canonical SMILES for (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone is CC1SCC(C(=O)C2CCOC3(CCCC3)C2)SC1C.
What is the InChIKey of (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone?
The InChIKey is KDRWXXKACFKOOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2S2/c1-11-12(2)20-14(10-19-11)15(17)13-5-8-18-16(9-13)6-3-4-7-16/h11-14H,3-10H2,1-2H3.
What are the key properties of (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone?
(5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone has a molecular weight of 314.52 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-dimethyl-1,4-dithian-2-yl)-(6-oxaspiro[4.5]decan-9-yl)methanone is sourced from PubChem (CID 103345007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).