About cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol
cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol (PubChem CID 103345165) has the molecular formula C10H18OS2
and a molecular weight of 218.39 g/mol. Its IUPAC name is cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol.
Molecular Properties
| Compound Name | cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol |
| PubChem CID | 103345165 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol |
| SMILES | CC1SCC(C(O)C2CC2)SC1C |
| InChI | InChI=1S/C10H18OS2/c1-6-7(2)13-9(5-12-6)10(11)8-3-4-8/h6-11H,3-5H2,1-2H3 |
| InChIKey | CTLZWFZXOYZLBG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol?
The IUPAC name of cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol (CID 103345165) is cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol.
What is the SMILES notation for cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol?
The canonical SMILES for cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol is CC1SCC(C(O)C2CC2)SC1C.
What is the InChIKey of cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol?
The InChIKey is CTLZWFZXOYZLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OS2/c1-6-7(2)13-9(5-12-6)10(11)8-3-4-8/h6-11H,3-5H2,1-2H3.
What are the key properties of cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol?
cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol has a molecular weight of 218.39 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol is sourced from PubChem (CID 103345165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).