C10H18OS2 — CID 103345165
cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol (PubChem CID 103345165) has the molecular formula C10H18OS2 and a molecular weight of 218.39 g/mol. Its IUPAC name is cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol.
| Compound Name | cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 103345165 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | cyclopropyl-(5,6-dimethyl-1,4-dithian-2-yl)methanol |
| SMILES | CC1SCC(C(O)C2CC2)SC1C |
| InChI | InChI=1S/C10H18OS2/c1-6-7(2)13-9(5-12-6)10(11)8-3-4-8/h6-11H,3-5H2,1-2H3 |
| InChIKey | CTLZWFZXOYZLBG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |