C10H18OS2 — CID 103345325
1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-en-1-ol (PubChem CID 103345325) has the molecular formula C10H18OS2 and a molecular weight of 218.39 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-en-1-ol.
| Compound Name | 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-en-1-ol |
|---|---|
| PubChem CID | 103345325 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-en-1-ol |
| SMILES | C=CCC(O)C1CSC(C)C(C)S1 |
| InChI | InChI=1S/C10H18OS2/c1-4-5-9(11)10-6-12-7(2)8(3)13-10/h4,7-11H,1,5-6H2,2-3H3 |
| InChIKey | LJYGMENWJXTDCR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|