C15H19N3S3 — CID 103346566
10-(5,6-dimethyl-1,4-dithian-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 103346566) has the molecular formula C15H19N3S3 and a molecular weight of 337.54 g/mol. Its IUPAC name is 10-(5,6-dimethyl-1,4-dithian-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | 10-(5,6-dimethyl-1,4-dithian-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 103346566 |
| Molecular Formula | C15H19N3S3 |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 10-(5,6-dimethyl-1,4-dithian-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | CC1SCC(c2nc(N)c3c4c(sc3n2)CCC4)SC1C |
| InChI | InChI=1S/C15H19N3S3/c1-7-8(2)20-11(6-19-7)14-17-13(16)12-9-4-3-5-10(9)21-15(12)18-14/h7-8,11H,3-6H2,1-2H3,(H2,16,17,18) |
| InChIKey | GEQLLJSQIHJTRF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |