C13H28N2S2 — CID 103347183
[1-(5,6-dimethyl-1,4-dithian-2-yl)-4,4-dimethylpentyl]hydrazine (PubChem CID 103347183) has the molecular formula C13H28N2S2 and a molecular weight of 276.51 g/mol. Its IUPAC name is [1-(5,6-dimethyl-1,4-dithian-2-yl)-4,4-dimethylpentyl]hydrazine.
| Compound Name | [1-(5,6-dimethyl-1,4-dithian-2-yl)-4,4-dimethylpentyl]hydrazine |
|---|---|
| PubChem CID | 103347183 |
| Molecular Formula | C13H28N2S2 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [1-(5,6-dimethyl-1,4-dithian-2-yl)-4,4-dimethylpentyl]hydrazine |
| SMILES | CC1SCC(C(CCC(C)(C)C)NN)SC1C |
| InChI | InChI=1S/C13H28N2S2/c1-9-10(2)17-12(8-16-9)11(15-14)6-7-13(3,4)5/h9-12,15H,6-8,14H2,1-5H3 |
| InChIKey | SJEIMSSYSQZQAX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|