C14H22N2OS2 — CID 103347185
[(5,6-dimethyl-1,4-dithian-2-yl)-(2-methoxyphenyl)methyl]hydrazine (PubChem CID 103347185) has the molecular formula C14H22N2OS2 and a molecular weight of 298.48 g/mol. Its IUPAC name is [(5,6-dimethyl-1,4-dithian-2-yl)-(2-methoxyphenyl)methyl]hydrazine.
| Compound Name | [(5,6-dimethyl-1,4-dithian-2-yl)-(2-methoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 103347185 |
| Molecular Formula | C14H22N2OS2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [(5,6-dimethyl-1,4-dithian-2-yl)-(2-methoxyphenyl)methyl]hydrazine |
| SMILES | COc1ccccc1C(NN)C1CSC(C)C(C)S1 |
| InChI | InChI=1S/C14H22N2OS2/c1-9-10(2)19-13(8-18-9)14(16-15)11-6-4-5-7-12(11)17-3/h4-7,9-10,13-14,16H,8,15H2,1-3H3 |
| InChIKey | INQYOGOFQLVLDJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|