About 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine
1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine (PubChem CID 103347205) has the molecular formula C10H18N2S2
and a molecular weight of 230.40 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine.
Molecular Properties
| Compound Name | 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine |
| PubChem CID | 103347205 |
| Molecular Formula | C10H18N2S2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine |
| SMILES | C#CCC(NN)C1CSC(C)C(C)S1 |
| InChI | InChI=1S/C10H18N2S2/c1-4-5-9(12-11)10-6-13-7(2)8(3)14-10/h1,7-10,12H,5-6,11H2,2-3H3 |
| InChIKey | ZLABYNUCPZGHBM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine?
The IUPAC name of 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine (CID 103347205) is 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine.
What is the SMILES notation for 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine?
The canonical SMILES for 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine is C#CCC(NN)C1CSC(C)C(C)S1.
What is the InChIKey of 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine?
The InChIKey is ZLABYNUCPZGHBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S2/c1-4-5-9(12-11)10-6-13-7(2)8(3)14-10/h1,7-10,12H,5-6,11H2,2-3H3.
What are the key properties of 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine?
1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine has a molecular weight of 230.40 g/mol, XLogP of 1.47, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dimethyl-1,4-dithian-2-yl)but-3-ynylhydrazine is sourced from PubChem (CID 103347205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).