About [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine
[(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine (PubChem CID 103347269) has the molecular formula C14H28N2O2S3
and a molecular weight of 352.59 g/mol. Its IUPAC name is [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine.
Molecular Properties
| Compound Name | [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
| PubChem CID | 103347269 |
| Molecular Formula | C14H28N2O2S3 |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
| SMILES | CC1SCC(C(NN)C2CCCC(S(C)(=O)=O)C2)SC1C |
| InChI | InChI=1S/C14H28N2O2S3/c1-9-10(2)20-13(8-19-9)14(16-15)11-5-4-6-12(7-11)21(3,17)18/h9-14,16H,4-8,15H2,1-3H3 |
| InChIKey | PQCBUUPTSGTYSW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine?
The IUPAC name of [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine (CID 103347269) is [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine.
What is the SMILES notation for [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine?
The canonical SMILES for [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine is CC1SCC(C(NN)C2CCCC(S(C)(=O)=O)C2)SC1C.
What is the InChIKey of [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine?
The InChIKey is PQCBUUPTSGTYSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2S3/c1-9-10(2)20-13(8-19-9)14(16-15)11-5-4-6-12(7-11)21(3,17)18/h9-14,16H,4-8,15H2,1-3H3.
What are the key properties of [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine?
[(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine has a molecular weight of 352.59 g/mol, XLogP of 2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(5,6-dimethyl-1,4-dithian-2-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine is sourced from PubChem (CID 103347269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).