C10H17N3O4S3 — CID 103348843
4-cyclopropylsulfonyl-5-N-(3-methylsulfonylpropyl)-1,2-thiazole-3,5-diamine (PubChem CID 103348843) has the molecular formula C10H17N3O4S3 and a molecular weight of 339.46 g/mol. Its IUPAC name is 4-cyclopropylsulfonyl-5-N-(3-methylsulfonylpropyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-cyclopropylsulfonyl-5-N-(3-methylsulfonylpropyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103348843 |
| Molecular Formula | C10H17N3O4S3 |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 4-cyclopropylsulfonyl-5-N-(3-methylsulfonylpropyl)-1,2-thiazole-3,5-diamine |
| SMILES | CS(=O)(=O)CCCNc1snc(N)c1S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C10H17N3O4S3/c1-19(14,15)6-2-5-12-10-8(9(11)13-18-10)20(16,17)7-3-4-7/h7,12H,2-6H2,1H3,(H2,11,13) |
| InChIKey | PAYARJHFMOLTEK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|