About 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol
1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol (PubChem CID 103349385) has the molecular formula C11H14N4OS2
and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol |
| PubChem CID | 103349385 |
| Molecular Formula | C11H14N4OS2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol |
| SMILES | Cc1csc(-c2c(N)nsc2N2CCC(O)C2)n1 |
| InChI | InChI=1S/C11H14N4OS2/c1-6-5-17-10(13-6)8-9(12)14-18-11(8)15-3-2-7(16)4-15/h5,7,16H,2-4H2,1H3,(H2,12,14) |
| InChIKey | OYQCLIVJVGPRCW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol?
The IUPAC name of 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol (CID 103349385) is 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol.
What is the SMILES notation for 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol?
The canonical SMILES for 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol is Cc1csc(-c2c(N)nsc2N2CCC(O)C2)n1.
What is the InChIKey of 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol?
The InChIKey is OYQCLIVJVGPRCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4OS2/c1-6-5-17-10(13-6)8-9(12)14-18-11(8)15-3-2-7(16)4-15/h5,7,16H,2-4H2,1H3,(H2,12,14).
What are the key properties of 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol?
1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol has a molecular weight of 282.39 g/mol, XLogP of 1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-amino-4-(4-methyl-1,3-thiazol-2-yl)-1,2-thiazol-5-yl]pyrrolidin-3-ol is sourced from PubChem (CID 103349385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).