C10H14F3N3O2S2 — CID 103349733
4-cyclopropylsulfonyl-5-N-(4,4,4-trifluorobutyl)-1,2-thiazole-3,5-diamine (PubChem CID 103349733) has the molecular formula C10H14F3N3O2S2 and a molecular weight of 329.37 g/mol. Its IUPAC name is 4-cyclopropylsulfonyl-5-N-(4,4,4-trifluorobutyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-cyclopropylsulfonyl-5-N-(4,4,4-trifluorobutyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103349733 |
| Molecular Formula | C10H14F3N3O2S2 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-cyclopropylsulfonyl-5-N-(4,4,4-trifluorobutyl)-1,2-thiazole-3,5-diamine |
| SMILES | Nc1nsc(NCCCC(F)(F)F)c1S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C10H14F3N3O2S2/c11-10(12,13)4-1-5-15-9-7(8(14)16-19-9)20(17,18)6-2-3-6/h6,15H,1-5H2,(H2,14,16) |
| InChIKey | GPDKAUTXYGCIOF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|